About 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide
2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide (PubChem CID 91475976) has the molecular formula C13H29NO2S
and a molecular weight of 263.45 g/mol. Its IUPAC name is 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide.
Molecular Properties
| Compound Name | 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide |
| PubChem CID | 91475976 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide |
| SMILES | CCC(C)CC(C)=CS.CNC(C)=O.COC |
| InChI | InChI=1S/C8H16S.C3H7NO.C2H6O/c1-4-7(2)5-8(3)6-9;1-3(5)4-2;1-3-2/h6-7,9H,4-5H2,1-3H3;1-2H3,(H,4,5);1-2H3 |
| InChIKey | VBROTMVDZCHHRF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide?
The IUPAC name of 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide (CID 91475976) is 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide.
What is the SMILES notation for 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide?
The canonical SMILES for 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide is CCC(C)CC(C)=CS.CNC(C)=O.COC.
What is the InChIKey of 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide?
The InChIKey is VBROTMVDZCHHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S.C3H7NO.C2H6O/c1-4-7(2)5-8(3)6-9;1-3(5)4-2;1-3-2/h6-7,9H,4-5H2,1-3H3;1-2H3,(H,4,5);1-2H3.
What are the key properties of 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide?
2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide has a molecular weight of 263.45 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylhex-1-ene-1-thiol;methoxymethane;N-methylacetamide is sourced from PubChem (CID 91475976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).