About 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane
4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane (PubChem CID 91476448) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane.
Molecular Properties
| Compound Name | 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane |
| PubChem CID | 91476448 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane |
| SMILES | CC.CNc1nc(Nc2cccc(C)c2)ncc1C |
| InChI | InChI=1S/C13H16N4.C2H6/c1-9-5-4-6-11(7-9)16-13-15-8-10(2)12(14-3)17-13;1-2/h4-8H,1-3H3,(H2,14,15,16,17);1-2H3 |
| InChIKey | OQMAXQAMUMRRKY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane?
The IUPAC name of 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane (CID 91476448) is 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane.
What is the SMILES notation for 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane?
The canonical SMILES for 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane is CC.CNc1nc(Nc2cccc(C)c2)ncc1C.
What is the InChIKey of 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane?
The InChIKey is OQMAXQAMUMRRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4.C2H6/c1-9-5-4-6-11(7-9)16-13-15-8-10(2)12(14-3)17-13;1-2/h4-8H,1-3H3,(H2,14,15,16,17);1-2H3.
What are the key properties of 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane?
4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane has a molecular weight of 258.37 g/mol, XLogP of 3.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-dimethyl-2-N-(3-methylphenyl)pyrimidine-2,4-diamine;ethane is sourced from PubChem (CID 91476448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).