C8H16N2O4S — CID 91476511
N,N-dimethyl-2-morpholin-4-yl-2-oxoethanesulfonamide (PubChem CID 91476511) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is N,N-dimethyl-2-morpholin-4-yl-2-oxoethanesulfonamide.
| Compound Name | N,N-dimethyl-2-morpholin-4-yl-2-oxoethanesulfonamide |
|---|---|
| PubChem CID | 91476511 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N,N-dimethyl-2-morpholin-4-yl-2-oxoethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C8H16N2O4S/c1-9(2)15(12,13)7-8(11)10-3-5-14-6-4-10/h3-7H2,1-2H3 |
| InChIKey | YORFTGABFZRQPE-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |