About 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid
2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid (PubChem CID 91476785) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid.
Analyze 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid?
The IUPAC name of 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid (CID 91476785) is 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid.
What is the SMILES notation for 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid?
The canonical SMILES for 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid is O=C(O)CC1CCCC2CCC(=O)C=C21.
What is the InChIKey of 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid?
The InChIKey is DZHQCSSDJOZTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c13-10-5-4-8-2-1-3-9(6-12(14)15)11(8)7-10/h7-9H,1-6H2,(H,14,15).
What are the key properties of 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid?
2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid has a molecular weight of 208.26 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-oxo-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl)acetic acid is sourced from PubChem (CID 91476785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).