C50H50 — CID 91477797
1-(3,5-diethynylphenyl)-3-[3-[3-(3,5-diethynylphenyl)-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane (PubChem CID 91477797) has the molecular formula C50H50 and a molecular weight of 650.95 g/mol. Its IUPAC name is 1-(3,5-diethynylphenyl)-3-[3-[3-(3,5-diethynylphenyl)-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane.
| Compound Name | 1-(3,5-diethynylphenyl)-3-[3-[3-(3,5-diethynylphenyl)-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane |
|---|---|
| PubChem CID | 91477797 |
| Molecular Formula | C50H50 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | 1-(3,5-diethynylphenyl)-3-[3-[3-(3,5-diethynylphenyl)-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4(C)CC(C)(C2)CC(c2cccc(C56CC7(C)CC(C)(CC(c8cc(C#C)cc(C#C)c8)(C7)C5)C6)c2)(C4)C3)c1 |
| InChI | InChI=1S/C50H50/c1-9-35-16-36(10-2)19-41(18-35)49-29-43(5)23-44(6,30-49)26-47(25-43,33-49)39-14-13-15-40(22-39)48-27-45(7)24-46(8,28-48)32-50(31-45,34-48)42-20-37(11-3)17-38(12-4)21-42/h1-4,13-22H,23-34H2,5-8H3 |
| InChIKey | TYYJJUYBSWHCLM-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|