C7H11FO3 — CID 91477847
(2R,3R,5S)-2-(2-fluoroethenyl)-5-methyloxolane-3,4-diol (PubChem CID 91477847) has the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. Its IUPAC name is (2R,3R,5S)-2-(2-fluoroethenyl)-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,5S)-2-(2-fluoroethenyl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91477847 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (2R,3R,5S)-2-(2-fluoroethenyl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](C=CF)[C@H](O)C1O |
| InChI | InChI=1S/C7H11FO3/c1-4-6(9)7(10)5(11-4)2-3-8/h2-7,9-10H,1H3/t4-,5+,6?,7-/m0/s1 |
| InChIKey | IOTWWEUUKJAFEJ-DIWXZTFISA-N |
| XLogP | -0.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |