C29H32N4O5 — CID 91477862
1-[3-(dihydroxymethyl)phenyl]-3-[5-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-phenyl-2,3-dihydro-1,5-benzodiazepin-3-yl]urea (PubChem CID 91477862) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is 1-[3-(dihydroxymethyl)phenyl]-3-[5-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-phenyl-2,3-dihydro-1,5-benzodiazepin-3-yl]urea.
| Compound Name | 1-[3-(dihydroxymethyl)phenyl]-3-[5-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-phenyl-2,3-dihydro-1,5-benzodiazepin-3-yl]urea |
|---|---|
| PubChem CID | 91477862 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 1-[3-(dihydroxymethyl)phenyl]-3-[5-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-phenyl-2,3-dihydro-1,5-benzodiazepin-3-yl]urea |
| SMILES | CC(C)(C)C(=O)CN1C(=O)C(NC(=O)Nc2cccc(C(O)O)c2)CN(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H32N4O5/c1-29(2,3)25(34)18-33-24-15-8-7-14-23(24)32(21-12-5-4-6-13-21)17-22(26(33)35)31-28(38)30-20-11-9-10-19(16-20)27(36)37/h4-16,22,27,36-37H,17-18H2,1-3H3,(H2,30,31,38) |
| InChIKey | WOPFCQUTPYRJOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|