C16H21N5O3S2 — CID 9147854
1-cyclopentyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetyl]amino]thiourea (PubChem CID 9147854) has the molecular formula C16H21N5O3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetyl]amino]thiourea.
| Compound Name | 1-cyclopentyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9147854 |
| Molecular Formula | C16H21N5O3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-cyclopentyl-3-[[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetyl]amino]thiourea |
| SMILES | CN(CC(=O)NNC(=S)NC1CCCC1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H21N5O3S2/c1-21(15-12-8-4-5-9-13(12)26(23,24)20-15)10-14(22)18-19-16(25)17-11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7,10H2,1H3,(H,18,22)(H2,17,19,25) |
| InChIKey | SKTXSHXEEJMXPV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|