C29H42N4O2 — CID 91479017
tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methyl]carbamate;ethane (PubChem CID 91479017) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 91479017 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methyl]carbamate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)NCC1CCN(c2nccc(-c3ccc4ccccc4c3)n2)CC1 |
| InChI | InChI=1S/C25H30N4O2.2C2H6/c1-25(2,3)31-24(30)27-17-18-11-14-29(15-12-18)23-26-13-10-22(28-23)21-9-8-19-6-4-5-7-20(19)16-21;2*1-2/h4-10,13,16,18H,11-12,14-15,17H2,1-3H3,(H,27,30);2*1-2H3 |
| InChIKey | WZXOVUSYDPEVKS-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |