About 3-methyl-1,2-diazabicyclo[2.2.2]octane
3-methyl-1,2-diazabicyclo[2.2.2]octane (PubChem CID 91479044) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-methyl-1,2-diazabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 3-methyl-1,2-diazabicyclo[2.2.2]octane |
| PubChem CID | 91479044 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 3-methyl-1,2-diazabicyclo[2.2.2]octane |
| SMILES | CC1NN2CCC1CC2 |
| InChI | InChI=1S/C7H14N2/c1-6-7-2-4-9(8-6)5-3-7/h6-8H,2-5H2,1H3 |
| InChIKey | NRYREWUFBGGXKE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1,2-diazabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2-diazabicyclo[2.2.2]octane?
The IUPAC name of 3-methyl-1,2-diazabicyclo[2.2.2]octane (CID 91479044) is 3-methyl-1,2-diazabicyclo[2.2.2]octane.
What is the SMILES notation for 3-methyl-1,2-diazabicyclo[2.2.2]octane?
The canonical SMILES for 3-methyl-1,2-diazabicyclo[2.2.2]octane is CC1NN2CCC1CC2.
What is the InChIKey of 3-methyl-1,2-diazabicyclo[2.2.2]octane?
The InChIKey is NRYREWUFBGGXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-6-7-2-4-9(8-6)5-3-7/h6-8H,2-5H2,1H3.
What are the key properties of 3-methyl-1,2-diazabicyclo[2.2.2]octane?
3-methyl-1,2-diazabicyclo[2.2.2]octane has a molecular weight of 126.20 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-diazabicyclo[2.2.2]octane is sourced from PubChem (CID 91479044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).