C28H25F6N3O2S — CID 91479270
N-[2-[3-[2,4-bis(trifluoromethyl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide (PubChem CID 91479270) has the molecular formula C28H25F6N3O2S and a molecular weight of 581.58 g/mol. Its IUPAC name is N-[2-[3-[2,4-bis(trifluoromethyl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide.
| Compound Name | N-[2-[3-[2,4-bis(trifluoromethyl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 91479270 |
| Molecular Formula | C28H25F6N3O2S |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | N-[2-[3-[2,4-bis(trifluoromethyl)phenyl]propylamino]ethyl]-7-phenylisoquinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCNCCCc1ccc(C(F)(F)F)cc1C(F)(F)F)c1cc(-c2ccccc2)cc2cnccc12 |
| InChI | InChI=1S/C28H25F6N3O2S/c29-27(30,31)23-9-8-20(25(17-23)28(32,33)34)7-4-11-35-13-14-37-40(38,39)26-16-21(19-5-2-1-3-6-19)15-22-18-36-12-10-24(22)26/h1-3,5-6,8-10,12,15-18,35,37H,4,7,11,13-14H2 |
| InChIKey | KAFGVIWVLMKQIP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|