C31H46O3 — CID 91479437
[(7R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 91479437) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is [(7R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [(7R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91479437 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | [(7R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,4,6,7,8,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)O[C@H]2CC=C3C4C(C5=C(CC(=O)CC5)C[C@H]4C)[C@@H](C)C[C@@]32C)CC1 |
| InChI | InChI=1S/C31H46O3/c1-5-6-7-21-8-10-22(11-9-21)30(33)34-27-15-14-26-29-19(2)16-23-17-24(32)12-13-25(23)28(29)20(3)18-31(26,27)4/h14,19-22,27-29H,5-13,15-18H2,1-4H3/t19-,20+,21?,22?,27+,28?,29?,31+/m1/s1 |
| InChIKey | MGTOCOAWTIAFAN-PODUWOGQSA-N |
| XLogP | 7.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|