C15H10N2O8 — CID 91479802
3-[3-(4-carboxy-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid (PubChem CID 91479802) has the molecular formula C15H10N2O8 and a molecular weight of 346.25 g/mol. Its IUPAC name is 3-[3-(4-carboxy-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid.
| Compound Name | 3-[3-(4-carboxy-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 91479802 |
| Molecular Formula | C15H10N2O8 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-[3-(4-carboxy-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid |
| SMILES | O=C1C=C(C(=O)O)C(=CC=Cc2c(C(=O)O)cc(=O)[nH]c2O)C(=O)N1 |
| InChI | InChI=1S/C15H10N2O8/c18-10-4-8(14(22)23)6(12(20)16-10)2-1-3-7-9(15(24)25)5-11(19)17-13(7)21/h1-5H,(H,22,23)(H,24,25)(H,16,18,20)(H2,17,19,21) |
| InChIKey | LAKRZGFKGWACGK-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|