C21H29NO5 — CID 91480483
methyl 6-(3-oxo-5,12-dioxa-2-azabicyclo[11.4.0]heptadeca-1(17),7,13,15-tetraen-4-yl)hexanoate (PubChem CID 91480483) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 6-(3-oxo-5,12-dioxa-2-azabicyclo[11.4.0]heptadeca-1(17),7,13,15-tetraen-4-yl)hexanoate.
| Compound Name | methyl 6-(3-oxo-5,12-dioxa-2-azabicyclo[11.4.0]heptadeca-1(17),7,13,15-tetraen-4-yl)hexanoate |
|---|---|
| PubChem CID | 91480483 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | methyl 6-(3-oxo-5,12-dioxa-2-azabicyclo[11.4.0]heptadeca-1(17),7,13,15-tetraen-4-yl)hexanoate |
| SMILES | COC(=O)CCCCCC1OCC=CCCCOc2ccccc2NC1=O |
| InChI | InChI=1S/C21H29NO5/c1-25-20(23)14-6-4-5-13-19-21(24)22-17-11-7-8-12-18(17)26-15-9-2-3-10-16-27-19/h3,7-8,10-12,19H,2,4-6,9,13-16H2,1H3,(H,22,24) |
| InChIKey | KWTXROBLHQQSOW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|