C11H13NO4 — CID 91480797
4-hydroxy-1-methoxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 91480797) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-hydroxy-1-methoxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | 4-hydroxy-1-methoxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91480797 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-hydroxy-1-methoxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | COC12C=CC(CC1)c1c2c(O)n(O)c1O |
| InChI | InChI=1S/C11H13NO4/c1-16-11-4-2-6(3-5-11)7-8(11)10(14)12(15)9(7)13/h2,4,6,13-15H,3,5H2,1H3 |
| InChIKey | SYMVEWCAUNDBHC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|