C22H19BrF2N4O2 — CID 91480999
N-(4-bromo-5-phenyl-1H-pyrazol-3-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pent-4-enamide (PubChem CID 91480999) has the molecular formula C22H19BrF2N4O2 and a molecular weight of 489.32 g/mol. Its IUPAC name is N-(4-bromo-5-phenyl-1H-pyrazol-3-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pent-4-enamide.
| Compound Name | N-(4-bromo-5-phenyl-1H-pyrazol-3-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pent-4-enamide |
|---|---|
| PubChem CID | 91480999 |
| Molecular Formula | C22H19BrF2N4O2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | N-(4-bromo-5-phenyl-1H-pyrazol-3-yl)-2-[[2-(3,5-difluorophenyl)acetyl]amino]pent-4-enamide |
| SMILES | C=CCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1n[nH]c(-c2ccccc2)c1Br |
| InChI | InChI=1S/C22H19BrF2N4O2/c1-2-6-17(26-18(30)11-13-9-15(24)12-16(25)10-13)22(31)27-21-19(23)20(28-29-21)14-7-4-3-5-8-14/h2-5,7-10,12,17H,1,6,11H2,(H,26,30)(H2,27,28,29,31) |
| InChIKey | CNUFBCXEUPKDOG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|