About (3-oxocyclopentyl) propanoate
(3-oxocyclopentyl) propanoate (PubChem CID 91481341) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (3-oxocyclopentyl) propanoate.
Molecular Properties
| Compound Name | (3-oxocyclopentyl) propanoate |
| PubChem CID | 91481341 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (3-oxocyclopentyl) propanoate |
| SMILES | CCC(=O)OC1CCC(=O)C1 |
| InChI | InChI=1S/C8H12O3/c1-2-8(10)11-7-4-3-6(9)5-7/h7H,2-5H2,1H3 |
| InChIKey | TWKAPXCMTMEPSY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-oxocyclopentyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclopentyl) propanoate?
The IUPAC name of (3-oxocyclopentyl) propanoate (CID 91481341) is (3-oxocyclopentyl) propanoate.
What is the SMILES notation for (3-oxocyclopentyl) propanoate?
The canonical SMILES for (3-oxocyclopentyl) propanoate is CCC(=O)OC1CCC(=O)C1.
What is the InChIKey of (3-oxocyclopentyl) propanoate?
The InChIKey is TWKAPXCMTMEPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-2-8(10)11-7-4-3-6(9)5-7/h7H,2-5H2,1H3.
What are the key properties of (3-oxocyclopentyl) propanoate?
(3-oxocyclopentyl) propanoate has a molecular weight of 156.18 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclopentyl) propanoate is sourced from PubChem (CID 91481341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).