C9H8N2O2 — CID 91481512
1,2-oxazol-4-yl(pyridin-3-yl)methanol (PubChem CID 91481512) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1,2-oxazol-4-yl(pyridin-3-yl)methanol.
| Compound Name | 1,2-oxazol-4-yl(pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 91481512 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1,2-oxazol-4-yl(pyridin-3-yl)methanol |
| SMILES | OC(c1cccnc1)c1cnoc1 |
| InChI | InChI=1S/C9H8N2O2/c12-9(8-5-11-13-6-8)7-2-1-3-10-4-7/h1-6,9,12H |
| InChIKey | QANNHGRJEFGMRV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |