C19H23F2N5OS — CID 91481521
[(6-amino-2,2-difluorocyclohexyl)amino]-(5-ethyl-4-imidazo[1,2-b]pyridazin-3-ylthiophen-2-yl)methanol (PubChem CID 91481521) has the molecular formula C19H23F2N5OS and a molecular weight of 407.49 g/mol. Its IUPAC name is [(6-amino-2,2-difluorocyclohexyl)amino]-(5-ethyl-4-imidazo[1,2-b]pyridazin-3-ylthiophen-2-yl)methanol.
| Compound Name | [(6-amino-2,2-difluorocyclohexyl)amino]-(5-ethyl-4-imidazo[1,2-b]pyridazin-3-ylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 91481521 |
| Molecular Formula | C19H23F2N5OS |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(6-amino-2,2-difluorocyclohexyl)amino]-(5-ethyl-4-imidazo[1,2-b]pyridazin-3-ylthiophen-2-yl)methanol |
| SMILES | CCc1sc(C(O)NC2C(N)CCCC2(F)F)cc1-c1cnc2cccnn12 |
| InChI | InChI=1S/C19H23F2N5OS/c1-2-14-11(13-10-23-16-6-4-8-24-26(13)16)9-15(28-14)18(27)25-17-12(22)5-3-7-19(17,20)21/h4,6,8-10,12,17-18,25,27H,2-3,5,7,22H2,1H3 |
| InChIKey | LEVDEQBTJUIHDT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|