C15H22O — CID 91481577
(2R,3S)-3-methyl-4-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]dec-4-enylidene]butan-2-ol (PubChem CID 91481577) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,3S)-3-methyl-4-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]dec-4-enylidene]butan-2-ol.
| Compound Name | (2R,3S)-3-methyl-4-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]dec-4-enylidene]butan-2-ol |
|---|---|
| PubChem CID | 91481577 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2R,3S)-3-methyl-4-[(1S,2S,6S,7S)-8-tricyclo[5.2.1.02,6]dec-4-enylidene]butan-2-ol |
| SMILES | C[C@@H](O)[C@@H](C)C=C1C[C@@H]2C[C@H]1[C@H]1C=CC[C@@H]21 |
| InChI | InChI=1S/C15H22O/c1-9(10(2)16)6-11-7-12-8-15(11)14-5-3-4-13(12)14/h3,5-6,9-10,12-16H,4,7-8H2,1-2H3/t9-,10+,12+,13-,14-,15+/m0/s1 |
| InChIKey | CFYWBOZLQRYGSN-RKKRGXIDSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|