About 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol
10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol (PubChem CID 91481871) has the molecular formula C26H20N4O
and a molecular weight of 404.47 g/mol. Its IUPAC name is 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol.
Molecular Properties
| Compound Name | 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol |
| PubChem CID | 91481871 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol |
| SMILES | OC1=c2ccc([nH]2)=C(c2ccccc2)c2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2 |
| InChI | InChI=1S/C26H20N4O/c31-26-23-11-9-20(29-23)15-18-7-6-17(27-18)14-19-8-10-21(28-19)25(16-4-2-1-3-5-16)22-12-13-24(26)30-22/h1-15,27-31H |
| InChIKey | RPFDXWDVIRIDMH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol?
The IUPAC name of 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol (CID 91481871) is 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol.
What is the SMILES notation for 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol?
The canonical SMILES for 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol is OC1=c2ccc([nH]2)=C(c2ccccc2)c2ccc([nH]2)C=c2ccc([nH]2)=Cc2ccc1[nH]2.
What is the InChIKey of 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol?
The InChIKey is RPFDXWDVIRIDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O/c31-26-23-11-9-20(29-23)15-18-7-6-17(27-18)14-19-8-10-21(28-19)25(16-4-2-1-3-5-16)22-12-13-24(26)30-22/h1-15,27-31H.
What are the key properties of 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol?
10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol has a molecular weight of 404.47 g/mol, XLogP of 1.93, 1 rotatable bonds, 5 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-phenyl-21,22,23,24-tetrahydroporphyrin-5-ol is sourced from PubChem (CID 91481871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).