About 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine
6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine (PubChem CID 91482385) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine |
| PubChem CID | 91482385 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine |
| SMILES | C1=CCC(C2=CCCC=N2)=C1 |
| InChI | InChI=1S/C10H11N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-2,5,7-8H,3-4,6H2 |
| InChIKey | CPCHOTBWHHWHCL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine?
The IUPAC name of 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine (CID 91482385) is 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine.
What is the SMILES notation for 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine?
The canonical SMILES for 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine is C1=CCC(C2=CCCC=N2)=C1.
What is the InChIKey of 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine?
The InChIKey is CPCHOTBWHHWHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-6-9(5-1)10-7-3-4-8-11-10/h1-2,5,7-8H,3-4,6H2.
What are the key properties of 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine?
6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine has a molecular weight of 145.20 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopenta-1,3-dien-1-yl-3,4-dihydropyridine is sourced from PubChem (CID 91482385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).