C38H42N4O — CID 91482631
4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]methyl]quinoline (PubChem CID 91482631) has the molecular formula C38H42N4O and a molecular weight of 570.78 g/mol. Its IUPAC name is 4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]methyl]quinoline.
| Compound Name | 4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]methyl]quinoline |
|---|---|
| PubChem CID | 91482631 |
| Molecular Formula | C38H42N4O |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 4-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethoxy]methyl]quinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O[C@H](c1ccnc2ccccc12)[C@@H]1C[C@@H]2CCN1C[C@@H]2C=C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C38H42N4O/c1-3-25-23-41-19-15-27(25)21-35(41)37(31-13-17-39-33-11-7-5-9-29(31)33)43-38(32-14-18-40-34-12-8-6-10-30(32)34)36-22-28-16-20-42(36)24-26(28)4-2/h3-14,17-18,25-28,35-38H,1-2,15-16,19-24H2/t25-,26-,27-,28-,35-,36-,37+,38+/m0/s1 |
| InChIKey | HGZSVSUBRJACBQ-OSUNJFJHSA-N |
| XLogP | 7.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|