About 10a,10b-dihydrobenzo[f]quinoline
10a,10b-dihydrobenzo[f]quinoline (PubChem CID 91482637) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 10a,10b-dihydrobenzo[f]quinoline.
Molecular Properties
| Compound Name | 10a,10b-dihydrobenzo[f]quinoline |
| PubChem CID | 91482637 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 10a,10b-dihydrobenzo[f]quinoline |
| SMILES | C1=CC2=CC=C3N=CC=CC3C2C=C1 |
| InChI | InChI=1S/C13H11N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9,11-12H |
| InChIKey | IBLCRRZXKZXWQU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10a,10b-dihydrobenzo[f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10a,10b-dihydrobenzo[f]quinoline?
The IUPAC name of 10a,10b-dihydrobenzo[f]quinoline (CID 91482637) is 10a,10b-dihydrobenzo[f]quinoline.
What is the SMILES notation for 10a,10b-dihydrobenzo[f]quinoline?
The canonical SMILES for 10a,10b-dihydrobenzo[f]quinoline is C1=CC2=CC=C3N=CC=CC3C2C=C1.
What is the InChIKey of 10a,10b-dihydrobenzo[f]quinoline?
The InChIKey is IBLCRRZXKZXWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9,11-12H.
What are the key properties of 10a,10b-dihydrobenzo[f]quinoline?
10a,10b-dihydrobenzo[f]quinoline has a molecular weight of 181.24 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10a,10b-dihydrobenzo[f]quinoline is sourced from PubChem (CID 91482637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).