C14H21FN2 — CID 91482859
(6E)-5-ethyl-6-(2-fluoropropyl)nona-4,6,8-triene-1,2-diimine (PubChem CID 91482859) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is (6E)-5-ethyl-6-(2-fluoropropyl)nona-4,6,8-triene-1,2-diimine.
| Compound Name | (6E)-5-ethyl-6-(2-fluoropropyl)nona-4,6,8-triene-1,2-diimine |
|---|---|
| PubChem CID | 91482859 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (6E)-5-ethyl-6-(2-fluoropropyl)nona-4,6,8-triene-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])CC=C(CC)/C(=C/C=C)CC(C)F |
| InChI | InChI=1S/C14H21FN2/c1-4-6-13(9-11(3)15)12(5-2)7-8-14(17)10-16/h4,6-7,10-11,16-17H,1,5,8-9H2,2-3H3/b12-7?,13-6+,16-10+,17-14- |
| InChIKey | WAJSDNBRLBUVCP-MTBQWWDMSA-N |
| XLogP | 4.24 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|