About 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane
2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane (PubChem CID 91483098) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane.
Analyze 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane?
The IUPAC name of 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane (CID 91483098) is 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane.
What is the SMILES notation for 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane?
The canonical SMILES for 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane is CC1CCC(C)C(C2CC(C)CCC2C)C1.
What is the InChIKey of 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane?
The InChIKey is UDUUQZATOSDJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-11-5-7-13(3)15(9-11)16-10-12(2)6-8-14(16)4/h11-16H,5-10H2,1-4H3.
What are the key properties of 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane?
2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane has a molecular weight of 222.42 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylcyclohexyl)-1,4-dimethylcyclohexane is sourced from PubChem (CID 91483098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).