About 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea
1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 91483682) has the molecular formula C20H26FN3O2S
and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea |
| PubChem CID | 91483682 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1ccc(CCN(C(=O)Nc2nccs2)C2CCC(C)CC2)cc1F |
| InChI | InChI=1S/C20H26FN3O2S/c1-14-3-6-16(7-4-14)24(20(25)23-19-22-10-12-27-19)11-9-15-5-8-18(26-2)17(21)13-15/h5,8,10,12-14,16H,3-4,6-7,9,11H2,1-2H3,(H,22,23,25) |
| InChIKey | ZDGVNEOAHJUUBP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea (CID 91483682) is 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea is COc1ccc(CCN(C(=O)Nc2nccs2)C2CCC(C)CC2)cc1F.
What is the InChIKey of 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea?
The InChIKey is ZDGVNEOAHJUUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3O2S/c1-14-3-6-16(7-4-14)24(20(25)23-19-22-10-12-27-19)11-9-15-5-8-18(26-2)17(21)13-15/h5,8,10,12-14,16H,3-4,6-7,9,11H2,1-2H3,(H,22,23,25).
What are the key properties of 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea?
1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea has a molecular weight of 391.51 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-fluoro-4-methoxyphenyl)ethyl]-1-(4-methylcyclohexyl)-3-(1,3-thiazol-2-yl)urea is sourced from PubChem (CID 91483682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).