C20H32N4O4 — CID 91483927
2-acetamido-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide (PubChem CID 91483927) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-acetamido-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide.
| Compound Name | 2-acetamido-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 91483927 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 2-acetamido-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
| SMILES | CC(=O)NC(C(=O)NC1C=CCCNC(=O)C=CC(C(C)C)NC1=O)C(C)C |
| InChI | InChI=1S/C20H32N4O4/c1-12(2)15-9-10-17(26)21-11-7-6-8-16(19(27)23-15)24-20(28)18(13(3)4)22-14(5)25/h6,8-10,12-13,15-16,18H,7,11H2,1-5H3,(H,21,26)(H,22,25)(H,23,27)(H,24,28) |
| InChIKey | QELHVLSNEGYAQU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|