C15H13N3O3 — CID 91483987
(2-oxo-6-phenyl-3,4-dihydro-1H-1,8-naphthyridin-3-yl)carbamic acid (PubChem CID 91483987) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (2-oxo-6-phenyl-3,4-dihydro-1H-1,8-naphthyridin-3-yl)carbamic acid.
| Compound Name | (2-oxo-6-phenyl-3,4-dihydro-1H-1,8-naphthyridin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 91483987 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2-oxo-6-phenyl-3,4-dihydro-1H-1,8-naphthyridin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1Cc2cc(-c3ccccc3)cnc2NC1=O |
| InChI | InChI=1S/C15H13N3O3/c19-14-12(17-15(20)21)7-10-6-11(8-16-13(10)18-14)9-4-2-1-3-5-9/h1-6,8,12,17H,7H2,(H,20,21)(H,16,18,19) |
| InChIKey | JYOAIKSNSXPMLX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |