C20H31P — CID 91484013
(2,2-dicyclohexyl-1-phenylethyl)phosphane (PubChem CID 91484013) has the molecular formula C20H31P and a molecular weight of 302.44 g/mol. Its IUPAC name is (2,2-dicyclohexyl-1-phenylethyl)phosphane.
| Compound Name | (2,2-dicyclohexyl-1-phenylethyl)phosphane |
|---|---|
| PubChem CID | 91484013 |
| Molecular Formula | C20H31P |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (2,2-dicyclohexyl-1-phenylethyl)phosphane |
| SMILES | PC(c1ccccc1)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H31P/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h3,8-9,14-17,19-20H,1-2,4-7,10-13,21H2 |
| InChIKey | LNRBGSRYRMWIKS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|