About (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate
(2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate (PubChem CID 91484061) has the molecular formula C11H7N5O7S
and a molecular weight of 353.27 g/mol. Its IUPAC name is (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate |
| PubChem CID | 91484061 |
| Molecular Formula | C11H7N5O7S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate |
| SMILES | O=c1[nH]c(=O)c2ncn(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)c2[nH]1 |
| InChI | InChI=1S/C11H7N5O7S/c17-10-8-9(13-11(18)14-10)15(5-12-8)23-24(21,22)7-3-1-2-6(4-7)16(19)20/h1-5H,(H2,13,14,17,18) |
| InChIKey | BWQSXJZJZLVTEP-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate?
The IUPAC name of (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate (CID 91484061) is (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate.
What is the SMILES notation for (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate?
The canonical SMILES for (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate is O=c1[nH]c(=O)c2ncn(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)c2[nH]1.
What is the InChIKey of (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate?
The InChIKey is BWQSXJZJZLVTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O7S/c17-10-8-9(13-11(18)14-10)15(5-12-8)23-24(21,22)7-3-1-2-6(4-7)16(19)20/h1-5H,(H2,13,14,17,18).
What are the key properties of (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate?
(2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate has a molecular weight of 353.27 g/mol, XLogP of -0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dioxo-3H-purin-9-yl) 3-nitrobenzenesulfonate is sourced from PubChem (CID 91484061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).