About 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide
3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide (PubChem CID 91484183) has the molecular formula C14H24N2O4S
and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide.
Molecular Properties
| Compound Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide |
| PubChem CID | 91484183 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide |
| SMILES | CCSc1cc(O)n(CCC(=O)NCCC(C)OC)c1O |
| InChI | InChI=1S/C14H24N2O4S/c1-4-21-11-9-13(18)16(14(11)19)8-6-12(17)15-7-5-10(2)20-3/h9-10,18-19H,4-8H2,1-3H3,(H,15,17) |
| InChIKey | FPAXWOWLUXAHCP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide?
The IUPAC name of 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide (CID 91484183) is 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide.
What is the SMILES notation for 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide?
The canonical SMILES for 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide is CCSc1cc(O)n(CCC(=O)NCCC(C)OC)c1O.
What is the InChIKey of 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide?
The InChIKey is FPAXWOWLUXAHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O4S/c1-4-21-11-9-13(18)16(14(11)19)8-6-12(17)15-7-5-10(2)20-3/h9-10,18-19H,4-8H2,1-3H3,(H,15,17).
What are the key properties of 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide?
3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide has a molecular weight of 316.42 g/mol, XLogP of 1.94, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylsulfanyl-2,5-dihydroxypyrrol-1-yl)-N-(3-methoxybutyl)propanamide is sourced from PubChem (CID 91484183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).