C26H37NO6S — CID 91484303
(4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-12-ene-2,6,14-trione (PubChem CID 91484303) has the molecular formula C26H37NO6S and a molecular weight of 491.65 g/mol. Its IUPAC name is (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-12-ene-2,6,14-trione.
| Compound Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-12-ene-2,6,14-trione |
|---|---|
| PubChem CID | 91484303 |
| Molecular Formula | C26H37NO6S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (4S,7R,8S,9S,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-12-ene-2,6,14-trione |
| SMILES | CC(=Cc1csc(C)n1)[C@@H]1CC(=O)C=CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H37NO6S/c1-15-9-7-8-10-20(28)12-21(16(2)11-19-14-34-18(4)27-19)33-23(30)13-22(29)26(5,6)25(32)17(3)24(15)31/h8,10-11,14-15,17,21-22,24,29,31H,7,9,12-13H2,1-6H3/t15-,17+,21-,22-,24-/m0/s1 |
| InChIKey | IZXGETSENSQJCJ-JKPLDMGGSA-N |
| XLogP | 4.06 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |