C16H20N4O — CID 91484454
12-(piperidin-1-ylmethyl)-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one (PubChem CID 91484454) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 12-(piperidin-1-ylmethyl)-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one.
| Compound Name | 12-(piperidin-1-ylmethyl)-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 91484454 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 12-(piperidin-1-ylmethyl)-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NNC(CN2CCCCC2)=C2CNc3cccc1c32 |
| InChI | InChI=1S/C16H20N4O/c21-16-11-5-4-6-13-15(11)12(9-17-13)14(18-19-16)10-20-7-2-1-3-8-20/h4-6,17-18H,1-3,7-10H2,(H,19,21) |
| InChIKey | ZDANQHCXNUNIKB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |