About 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid
6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid (PubChem CID 91484720) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid.
Molecular Properties
| Compound Name | 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid |
| PubChem CID | 91484720 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid |
| SMILES | O=C(O)N1CCn2cncc2C1 |
| InChI | InChI=1S/C7H9N3O2/c11-7(12)9-1-2-10-5-8-3-6(10)4-9/h3,5H,1-2,4H2,(H,11,12) |
| InChIKey | PWFLAHNAMVDOQT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The IUPAC name of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid (CID 91484720) is 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid.
What is the SMILES notation for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The canonical SMILES for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid is O=C(O)N1CCn2cncc2C1.
What is the InChIKey of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The InChIKey is PWFLAHNAMVDOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c11-7(12)9-1-2-10-5-8-3-6(10)4-9/h3,5H,1-2,4H2,(H,11,12).
What are the key properties of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid has a molecular weight of 167.17 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid is sourced from PubChem (CID 91484720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).