6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid

C7H9N3O2 — CID 91484720

IUPAC6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid
SMILESO=C(O)N1CCn2cncc2C1
InChIInChI=1S/C7H9N3O2/c11-7(12)9-1-2-10-5-8-3-6(10)4-9/h3,5H,1-2,4H2,(H,11,12)
InChIKeyPWFLAHNAMVDOQT-UHFFFAOYSA-N
MW167.17 g/mol
LogP0.38
Rot. Bonds

About 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid

6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid (PubChem CID 91484720) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid.

Molecular Properties

Compound Name6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid
PubChem CID91484720
Molecular FormulaC7H9N3O2
Molecular Weight167.17 g/mol
Exact Mass167.07
IUPAC Name6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid
SMILESO=C(O)N1CCn2cncc2C1
InChIInChI=1S/C7H9N3O2/c11-7(12)9-1-2-10-5-8-3-6(10)4-9/h3,5H,1-2,4H2,(H,11,12)
InChIKeyPWFLAHNAMVDOQT-UHFFFAOYSA-N
XLogP0.38
TPSA58.36 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.17
LogP ≤ 50.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The IUPAC name of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid (CID 91484720) is 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid.
What is the SMILES notation for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The canonical SMILES for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid is O=C(O)N1CCn2cncc2C1.
What is the InChIKey of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
The InChIKey is PWFLAHNAMVDOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c11-7(12)9-1-2-10-5-8-3-6(10)4-9/h3,5H,1-2,4H2,(H,11,12).
What are the key properties of 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid?
6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid has a molecular weight of 167.17 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylic acid is sourced from PubChem (CID 91484720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).