C41H35N5OS — CID 91485063
(1S)-1-[6-[6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazol-2-yl]butan-1-ol (PubChem CID 91485063) has the molecular formula C41H35N5OS and a molecular weight of 645.83 g/mol. Its IUPAC name is (1S)-1-[6-[6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazol-2-yl]butan-1-ol.
| Compound Name | (1S)-1-[6-[6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazol-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 91485063 |
| Molecular Formula | C41H35N5OS |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | (1S)-1-[6-[6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazol-2-yl]butan-1-ol |
| SMILES | CCC[C@H](O)c1nc2ccc(-c3cnc4ccc(-c5cn(C(c6ccccc6)(c6ccccc6)c6ccccc6)nc5C)cn34)cc2s1 |
| InChI | InChI=1S/C41H35N5OS/c1-3-13-37(47)40-43-35-22-20-29(24-38(35)48-40)36-25-42-39-23-21-30(26-45(36)39)34-27-46(44-28(34)2)41(31-14-7-4-8-15-31,32-16-9-5-10-17-32)33-18-11-6-12-19-33/h4-12,14-27,37,47H,3,13H2,1-2H3/t37-/m0/s1 |
| InChIKey | GZFIZYQTHMIILZ-QNGWXLTQSA-N |
| XLogP | 9.46 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|