C13H16O4 — CID 91485092
3-methyl-8-oxo-2,3,3a,4,5,6,7,9a-octahydrofuro[2,3-b]chromene-6-carbaldehyde (PubChem CID 91485092) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-methyl-8-oxo-2,3,3a,4,5,6,7,9a-octahydrofuro[2,3-b]chromene-6-carbaldehyde.
| Compound Name | 3-methyl-8-oxo-2,3,3a,4,5,6,7,9a-octahydrofuro[2,3-b]chromene-6-carbaldehyde |
|---|---|
| PubChem CID | 91485092 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-methyl-8-oxo-2,3,3a,4,5,6,7,9a-octahydrofuro[2,3-b]chromene-6-carbaldehyde |
| SMILES | CC1COC2OC3=C(CC(C=O)CC3=O)CC12 |
| InChI | InChI=1S/C13H16O4/c1-7-6-16-13-10(7)4-9-2-8(5-14)3-11(15)12(9)17-13/h5,7-8,10,13H,2-4,6H2,1H3 |
| InChIKey | NZQCLKUKXNHLJC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|