About 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide
3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide (PubChem CID 91485178) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide.
Molecular Properties
| Compound Name | 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide |
| PubChem CID | 91485178 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide |
| SMILES | CC[C@@H]1OCC(O)[C@@H]1NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C15H27NO3/c1-2-13-15(12(17)10-19-13)16-14(18)9-8-11-6-4-3-5-7-11/h11-13,15,17H,2-10H2,1H3,(H,16,18)/t12?,13-,15-/m0/s1 |
| InChIKey | GCRJCPYNBMUGEV-MHEXWIEDSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide?
The IUPAC name of 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide (CID 91485178) is 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide.
What is the SMILES notation for 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide?
The canonical SMILES for 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide is CC[C@@H]1OCC(O)[C@@H]1NC(=O)CCC1CCCCC1.
What is the InChIKey of 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide?
The InChIKey is GCRJCPYNBMUGEV-MHEXWIEDSA-N. The full InChI is InChI=1S/C15H27NO3/c1-2-13-15(12(17)10-19-13)16-14(18)9-8-11-6-4-3-5-7-11/h11-13,15,17H,2-10H2,1H3,(H,16,18)/t12?,13-,15-/m0/s1.
What are the key properties of 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide?
3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide has a molecular weight of 269.38 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N-[(2S,3S)-2-ethyl-4-hydroxyoxolan-3-yl]propanamide is sourced from PubChem (CID 91485178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).