C28H48N2 — CID 91485256
6-[2-(6-but-2-en-2-ylcyclohexa-2,4-dien-1-yl)-2-pyrrolidin-1-ylethyl]-N,6-dimethyldecan-5-imine (PubChem CID 91485256) has the molecular formula C28H48N2 and a molecular weight of 412.71 g/mol. Its IUPAC name is 6-[2-(6-but-2-en-2-ylcyclohexa-2,4-dien-1-yl)-2-pyrrolidin-1-ylethyl]-N,6-dimethyldecan-5-imine.
| Compound Name | 6-[2-(6-but-2-en-2-ylcyclohexa-2,4-dien-1-yl)-2-pyrrolidin-1-ylethyl]-N,6-dimethyldecan-5-imine |
|---|---|
| PubChem CID | 91485256 |
| Molecular Formula | C28H48N2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.38 |
| IUPAC Name | 6-[2-(6-but-2-en-2-ylcyclohexa-2,4-dien-1-yl)-2-pyrrolidin-1-ylethyl]-N,6-dimethyldecan-5-imine |
| SMILES | CC=C(C)C1C=CC=CC1C(CC(C)(CCCC)/C(CCCC)=N/C)N1CCCC1 |
| InChI | InChI=1S/C28H48N2/c1-7-10-18-27(29-6)28(5,19-11-8-2)22-26(30-20-14-15-21-30)25-17-13-12-16-24(25)23(4)9-3/h9,12-13,16-17,24-26H,7-8,10-11,14-15,18-22H2,1-6H3/b23-9?,29-27+ |
| InChIKey | AQBNKOOPSQNNMC-YSPOWVKVSA-N |
| XLogP | 7.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|