C11H11F6NO2 — CID 91485306
1-(4,4,5,5,6,6-hexafluoroheptyl)pyrrole-2,5-dione (PubChem CID 91485306) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-(4,4,5,5,6,6-hexafluoroheptyl)pyrrole-2,5-dione.
| Compound Name | 1-(4,4,5,5,6,6-hexafluoroheptyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 91485306 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(4,4,5,5,6,6-hexafluoroheptyl)pyrrole-2,5-dione |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H11F6NO2/c1-9(12,13)11(16,17)10(14,15)5-2-6-18-7(19)3-4-8(18)20/h3-4H,2,5-6H2,1H3 |
| InChIKey | YBCYPBNXFRWODO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|