C14H17F2N5O6 — CID 91485462
[(1S)-10-(2-ethoxy-1,1-difluoro-2-oxoethoxy)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]methylcarbamic acid (PubChem CID 91485462) has the molecular formula C14H17F2N5O6 and a molecular weight of 389.32 g/mol. Its IUPAC name is [(1S)-10-(2-ethoxy-1,1-difluoro-2-oxoethoxy)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]methylcarbamic acid.
| Compound Name | [(1S)-10-(2-ethoxy-1,1-difluoro-2-oxoethoxy)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 91485462 |
| Molecular Formula | C14H17F2N5O6 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(1S)-10-(2-ethoxy-1,1-difluoro-2-oxoethoxy)-1-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]methylcarbamic acid |
| SMILES | CCOC(=O)C(F)(F)ON1C(=O)N2C[C@]1(C)c1cn[nH]c1C2CNC(=O)O |
| InChI | InChI=1S/C14H17F2N5O6/c1-3-26-10(22)14(15,16)27-21-12(25)20-6-13(21,2)7-4-18-19-9(7)8(20)5-17-11(23)24/h4,8,17H,3,5-6H2,1-2H3,(H,18,19)(H,23,24)/t8?,13-/m1/s1 |
| InChIKey | VMBOFUFUCHLPQP-AZMWARKLSA-N |
| XLogP | 0.77 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |