3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid

C20H19NO3 — CID 91485949

IUPAC3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid
SMILESCC1(C)Cc2cc(C(=O)O)ccc2C(CC(=O)c2ccccc2)=N1
InChIInChI=1S/C20H19NO3/c1-20(2)12-15-10-14(19(23)24)8-9-16(15)17(21-20)11-18(22)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,23,24)
InChIKeyTWDODBUXRKOAJT-UHFFFAOYSA-N
MW321.38 g/mol
LogP3.78
Rot. Bonds4

About 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid

3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid (PubChem CID 91485949) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid.

Molecular Properties

Compound Name3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid
PubChem CID91485949
Molecular FormulaC20H19NO3
Molecular Weight321.38 g/mol
Exact Mass321.14
IUPAC Name3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid
SMILESCC1(C)Cc2cc(C(=O)O)ccc2C(CC(=O)c2ccccc2)=N1
InChIInChI=1S/C20H19NO3/c1-20(2)12-15-10-14(19(23)24)8-9-16(15)17(21-20)11-18(22)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,23,24)
InChIKeyTWDODBUXRKOAJT-UHFFFAOYSA-N
XLogP3.78
TPSA66.73 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.38
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid?
The IUPAC name of 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid (CID 91485949) is 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid.
What is the SMILES notation for 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid?
The canonical SMILES for 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid is CC1(C)Cc2cc(C(=O)O)ccc2C(CC(=O)c2ccccc2)=N1.
What is the InChIKey of 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid?
The InChIKey is TWDODBUXRKOAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO3/c1-20(2)12-15-10-14(19(23)24)8-9-16(15)17(21-20)11-18(22)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,23,24).
What are the key properties of 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid?
3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid has a molecular weight of 321.38 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carboxylic acid is sourced from PubChem (CID 91485949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).