About [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate
[2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate (PubChem CID 91486087) has the molecular formula C20H38O8
and a molecular weight of 406.52 g/mol. Its IUPAC name is [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate |
| PubChem CID | 91486087 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCOCOCC1CCC(OC(=O)C(C)(C)CC)C(OCOCCC(O)O)C1 |
| InChI | InChI=1S/C20H38O8/c1-5-20(3,4)19(23)28-16-8-7-15(12-26-13-24-6-2)11-17(16)27-14-25-10-9-18(21)22/h15-18,21-22H,5-14H2,1-4H3 |
| InChIKey | FQVFFKNBSBJMRY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate?
The IUPAC name of [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate (CID 91486087) is [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate?
The canonical SMILES for [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate is CCOCOCC1CCC(OC(=O)C(C)(C)CC)C(OCOCCC(O)O)C1.
What is the InChIKey of [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate?
The InChIKey is FQVFFKNBSBJMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O8/c1-5-20(3,4)19(23)28-16-8-7-15(12-26-13-24-6-2)11-17(16)27-14-25-10-9-18(21)22/h15-18,21-22H,5-14H2,1-4H3.
What are the key properties of [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate?
[2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate has a molecular weight of 406.52 g/mol, XLogP of 2.21, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3-dihydroxypropoxymethoxy)-4-(ethoxymethoxymethyl)cyclohexyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 91486087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).