C25H38FN5O5 — CID 91486192
N-(cyclopentylmethyl)-2-[(5-fluoro-2-morpholin-4-ylphenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 91486192) has the molecular formula C25H38FN5O5 and a molecular weight of 507.61 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2-[(5-fluoro-2-morpholin-4-ylphenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | N-(cyclopentylmethyl)-2-[(5-fluoro-2-morpholin-4-ylphenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 91486192 |
| Molecular Formula | C25H38FN5O5 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | N-(cyclopentylmethyl)-2-[(5-fluoro-2-morpholin-4-ylphenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(NC(=O)Nc1cc(F)ccc1N1CCOCC1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C25H38FN5O5/c1-25(2,3)22(23(33)31(16-21(32)29-35)15-17-6-4-5-7-17)28-24(34)27-19-14-18(26)8-9-20(19)30-10-12-36-13-11-30/h8-9,14,17,22,35H,4-7,10-13,15-16H2,1-3H3,(H,29,32)(H2,27,28,34) |
| InChIKey | KQKYFTZNGCMIPG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|