C25H24F2N6O — CID 91486720
4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2,5-difluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 91486720) has the molecular formula C25H24F2N6O and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2,5-difluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2,5-difluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91486720 |
| Molecular Formula | C25H24F2N6O |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2,5-difluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CCc1cccc(N(Cc2nc(-c3ccccc3)nn2C)c2cc(F)c(C(N)=NO)cc2F)c1 |
| InChI | InChI=1S/C25H24F2N6O/c1-3-16-8-7-11-18(12-16)33(22-14-20(26)19(13-21(22)27)24(28)31-34)15-23-29-25(30-32(23)2)17-9-5-4-6-10-17/h4-14,34H,3,15H2,1-2H3,(H2,28,31) |
| InChIKey | DALDHONVVAYOFW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|