About N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide
N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide (PubChem CID 91486876) has the molecular formula C18H24N4O2S
and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide |
| PubChem CID | 91486876 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide |
| SMILES | CC(CCCCCNS(C)(=O)=O)c1nc2ccccc2c2nc[nH]c12 |
| InChI | InChI=1S/C18H24N4O2S/c1-13(8-4-3-7-11-21-25(2,23)24)16-18-17(19-12-20-18)14-9-5-6-10-15(14)22-16/h5-6,9-10,12-13,21H,3-4,7-8,11H2,1-2H3,(H,19,20) |
| InChIKey | VITZOTKMDYZFCX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide?
The IUPAC name of N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide (CID 91486876) is N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide.
What is the SMILES notation for N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide?
The canonical SMILES for N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide is CC(CCCCCNS(C)(=O)=O)c1nc2ccccc2c2nc[nH]c12.
What is the InChIKey of N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide?
The InChIKey is VITZOTKMDYZFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2S/c1-13(8-4-3-7-11-21-25(2,23)24)16-18-17(19-12-20-18)14-9-5-6-10-15(14)22-16/h5-6,9-10,12-13,21H,3-4,7-8,11H2,1-2H3,(H,19,20).
What are the key properties of N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide?
N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide has a molecular weight of 360.48 g/mol, XLogP of 3.32, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3H-imidazo[4,5-c]quinolin-4-yl)heptyl]methanesulfonamide is sourced from PubChem (CID 91486876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).