About methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate
methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate (PubChem CID 91487792) has the molecular formula C20H19NO5S
and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate.
Molecular Properties
| Compound Name | methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate |
| PubChem CID | 91487792 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate |
| SMILES | COC(=O)c1c(OC)cc(-c2cc(-c3ccc(OC)cc3)ns2)cc1OC |
| InChI | InChI=1S/C20H19NO5S/c1-23-14-7-5-12(6-8-14)15-11-18(27-21-15)13-9-16(24-2)19(20(22)26-4)17(10-13)25-3/h5-11H,1-4H3 |
| InChIKey | CHHHMGGGIDYELN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate?
The IUPAC name of methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate (CID 91487792) is methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate.
What is the SMILES notation for methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate?
The canonical SMILES for methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate is COC(=O)c1c(OC)cc(-c2cc(-c3ccc(OC)cc3)ns2)cc1OC.
What is the InChIKey of methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate?
The InChIKey is CHHHMGGGIDYELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5S/c1-23-14-7-5-12(6-8-14)15-11-18(27-21-15)13-9-16(24-2)19(20(22)26-4)17(10-13)25-3/h5-11H,1-4H3.
What are the key properties of methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate?
methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate has a molecular weight of 385.44 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dimethoxy-4-[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]benzoate is sourced from PubChem (CID 91487792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).