About cyclohepta[d]pyrimidine
cyclohepta[d]pyrimidine (PubChem CID 91488165) has the molecular formula C9H6N2
and a molecular weight of 142.16 g/mol. Its IUPAC name is cyclohepta[d]pyrimidine.
Molecular Properties
| Compound Name | cyclohepta[d]pyrimidine |
| PubChem CID | 91488165 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | cyclohepta[d]pyrimidine |
| SMILES | C1=CC=Cc2ncncc2C=1 |
| InChI | InChI=1S/C9H6N2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h1,3-7H |
| InChIKey | JLJVTWZANIFAET-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohepta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[d]pyrimidine?
The IUPAC name of cyclohepta[d]pyrimidine (CID 91488165) is cyclohepta[d]pyrimidine.
What is the SMILES notation for cyclohepta[d]pyrimidine?
The canonical SMILES for cyclohepta[d]pyrimidine is C1=CC=Cc2ncncc2C=1.
What is the InChIKey of cyclohepta[d]pyrimidine?
The InChIKey is JLJVTWZANIFAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2/c1-2-4-8-6-10-7-11-9(8)5-3-1/h1,3-7H.
What are the key properties of cyclohepta[d]pyrimidine?
cyclohepta[d]pyrimidine has a molecular weight of 142.16 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[d]pyrimidine is sourced from PubChem (CID 91488165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).