About 3,3-dimethylpiperazin-2-one;ethane
3,3-dimethylpiperazin-2-one;ethane (PubChem CID 91488380) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3,3-dimethylpiperazin-2-one;ethane.
Molecular Properties
| Compound Name | 3,3-dimethylpiperazin-2-one;ethane |
| PubChem CID | 91488380 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 3,3-dimethylpiperazin-2-one;ethane |
| SMILES | CC.CC1(C)NCCNC1=O |
| InChI | InChI=1S/C6H12N2O.C2H6/c1-6(2)5(9)7-3-4-8-6;1-2/h8H,3-4H2,1-2H3,(H,7,9);1-2H3 |
| InChIKey | NGHMBXSKLAACBP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethylpiperazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpiperazin-2-one;ethane?
The IUPAC name of 3,3-dimethylpiperazin-2-one;ethane (CID 91488380) is 3,3-dimethylpiperazin-2-one;ethane.
What is the SMILES notation for 3,3-dimethylpiperazin-2-one;ethane?
The canonical SMILES for 3,3-dimethylpiperazin-2-one;ethane is CC.CC1(C)NCCNC1=O.
What is the InChIKey of 3,3-dimethylpiperazin-2-one;ethane?
The InChIKey is NGHMBXSKLAACBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H6/c1-6(2)5(9)7-3-4-8-6;1-2/h8H,3-4H2,1-2H3,(H,7,9);1-2H3.
What are the key properties of 3,3-dimethylpiperazin-2-one;ethane?
3,3-dimethylpiperazin-2-one;ethane has a molecular weight of 158.24 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpiperazin-2-one;ethane is sourced from PubChem (CID 91488380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).