About quinolin-2-yl (2S)-2-(decanoylamino)propanoate
quinolin-2-yl (2S)-2-(decanoylamino)propanoate (PubChem CID 91488832) has the molecular formula C22H30N2O3
and a molecular weight of 370.49 g/mol. Its IUPAC name is quinolin-2-yl (2S)-2-(decanoylamino)propanoate.
Molecular Properties
| Compound Name | quinolin-2-yl (2S)-2-(decanoylamino)propanoate |
| PubChem CID | 91488832 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | quinolin-2-yl (2S)-2-(decanoylamino)propanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](C)C(=O)Oc1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H30N2O3/c1-3-4-5-6-7-8-9-14-20(25)23-17(2)22(26)27-21-16-15-18-12-10-11-13-19(18)24-21/h10-13,15-17H,3-9,14H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | VAGNUXBSDNRUFV-KRWDZBQOSA-N |
| XLogP | 4.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze quinolin-2-yl (2S)-2-(decanoylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-yl (2S)-2-(decanoylamino)propanoate?
The IUPAC name of quinolin-2-yl (2S)-2-(decanoylamino)propanoate (CID 91488832) is quinolin-2-yl (2S)-2-(decanoylamino)propanoate.
What is the SMILES notation for quinolin-2-yl (2S)-2-(decanoylamino)propanoate?
The canonical SMILES for quinolin-2-yl (2S)-2-(decanoylamino)propanoate is CCCCCCCCCC(=O)N[C@@H](C)C(=O)Oc1ccc2ccccc2n1.
What is the InChIKey of quinolin-2-yl (2S)-2-(decanoylamino)propanoate?
The InChIKey is VAGNUXBSDNRUFV-KRWDZBQOSA-N. The full InChI is InChI=1S/C22H30N2O3/c1-3-4-5-6-7-8-9-14-20(25)23-17(2)22(26)27-21-16-15-18-12-10-11-13-19(18)24-21/h10-13,15-17H,3-9,14H2,1-2H3,(H,23,25)/t17-/m0/s1.
What are the key properties of quinolin-2-yl (2S)-2-(decanoylamino)propanoate?
quinolin-2-yl (2S)-2-(decanoylamino)propanoate has a molecular weight of 370.49 g/mol, XLogP of 4.79, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-yl (2S)-2-(decanoylamino)propanoate is sourced from PubChem (CID 91488832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).